C28H25Cl2N3O4S — CID 83277810
2,4-dichloro-N-[4-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277810) has the molecular formula C28H25Cl2N3O4S and a molecular weight of 570.50 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277810 |
| Molecular Formula | C28H25Cl2N3O4S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 2,4-dichloro-N-[4-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C)cc2)=C(Sc2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2)C1=O |
| InChI | InChI=1S/C28H25Cl2N3O4S/c1-17-4-7-19(8-5-17)31-24-25(28(36)33(27(24)35)14-3-15-37-2)38-21-11-9-20(10-12-21)32-26(34)22-13-6-18(29)16-23(22)30/h4-13,16,31H,3,14-15H2,1-2H3,(H,32,34) |
| InChIKey | ORPGZQIZOAZXHN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|