C27H23Cl2N3O4S — CID 83274315
N-[4-[4-anilino-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dichlorobenzamide (PubChem CID 83274315) has the molecular formula C27H23Cl2N3O4S and a molecular weight of 556.47 g/mol. Its IUPAC name is N-[4-[4-anilino-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[4-anilino-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 83274315 |
| Molecular Formula | C27H23Cl2N3O4S |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | N-[4-[4-anilino-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dichlorobenzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccccc2)=C(Sc2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2)C1=O |
| InChI | InChI=1S/C27H23Cl2N3O4S/c1-36-15-5-14-32-26(34)23(30-18-6-3-2-4-7-18)24(27(32)35)37-20-11-9-19(10-12-20)31-25(33)21-13-8-17(28)16-22(21)29/h2-4,6-13,16,30H,5,14-15H2,1H3,(H,31,33) |
| InChIKey | YNWBEMGXHCCSJV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|