C30H24ClN3O4S — CID 83277298
3-chloro-N-[4-[4-(3,4-dimethylanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277298) has the molecular formula C30H24ClN3O4S and a molecular weight of 558.06 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(3,4-dimethylanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[4-(3,4-dimethylanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277298 |
| Molecular Formula | C30H24ClN3O4S |
| Molecular Weight | 558.06 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 3-chloro-N-[4-[4-(3,4-dimethylanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3ccc(NC(=O)c4cccc(Cl)c4)cc3)C(=O)N(Cc3ccco3)C2=O)cc1C |
| InChI | InChI=1S/C30H24ClN3O4S/c1-18-8-9-23(15-19(18)2)32-26-27(30(37)34(29(26)36)17-24-7-4-14-38-24)39-25-12-10-22(11-13-25)33-28(35)20-5-3-6-21(31)16-20/h3-16,32H,17H2,1-2H3,(H,33,35) |
| InChIKey | QFSUFVNACPHLSJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.06 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|