C30H25N3O4S — CID 83273103
N-[4-[2,5-dioxo-1-phenyl-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 83273103) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is N-[4-[2,5-dioxo-1-phenyl-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2,5-dioxo-1-phenyl-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 83273103 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[4-[2,5-dioxo-1-phenyl-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(NC2=C(Sc3ccc(NC(=O)c4ccco4)cc3)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H25N3O4S/c1-19(2)20-10-12-21(13-11-20)31-26-27(30(36)33(29(26)35)23-7-4-3-5-8-23)38-24-16-14-22(15-17-24)32-28(34)25-9-6-18-37-25/h3-19,31H,1-2H3,(H,32,34) |
| InChIKey | VJTAJHYMLQIPIX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|