C23H24N2O3 — CID 55388221
N-[4-[1-(4-propan-2-ylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55388221) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[4-[1-(4-propan-2-ylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[1-(4-propan-2-ylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55388221 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[4-[1-(4-propan-2-ylphenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(C(C)NC(=O)c2ccc(NC(=O)c3ccco3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-15(2)17-6-8-18(9-7-17)16(3)24-22(26)19-10-12-20(13-11-19)25-23(27)21-5-4-14-28-21/h4-16H,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | WRIBNNUMGQXUFZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |