C20H17BrN2O3 — CID 9152076
N-[4-[[(1R)-1-(2-bromophenyl)ethyl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9152076) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is N-[4-[[(1R)-1-(2-bromophenyl)ethyl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(1R)-1-(2-bromophenyl)ethyl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9152076 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[4-[[(1R)-1-(2-bromophenyl)ethyl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc(NC(=O)c2ccco2)cc1)c1ccccc1Br |
| InChI | InChI=1S/C20H17BrN2O3/c1-13(16-5-2-3-6-17(16)21)22-19(24)14-8-10-15(11-9-14)23-20(25)18-7-4-12-26-18/h2-13H,1H3,(H,22,24)(H,23,25)/t13-/m1/s1 |
| InChIKey | VVLCAQCNYLUYCZ-CYBMUJFWSA-N |
| XLogP | 4.79 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |