C17H19BrN2O3 — CID 51181201
N-[4-[1-(2-bromophenyl)ethylamino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 51181201) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is N-[4-[1-(2-bromophenyl)ethylamino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[1-(2-bromophenyl)ethylamino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51181201 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-[4-[1-(2-bromophenyl)ethylamino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1ccco1)c1ccccc1Br |
| InChI | InChI=1S/C17H19BrN2O3/c1-12(13-6-2-3-7-14(13)18)20-16(21)9-4-10-19-17(22)15-8-5-11-23-15/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | OEYKKMILAUEQDW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|