C18H20N2O5 — CID 42934368
N-[4-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 42934368) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[4-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42934368 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[4-[1-(1,3-benzodioxol-5-yl)ethylamino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1ccco1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O5/c1-12(13-6-7-14-16(10-13)25-11-24-14)20-17(21)5-2-8-19-18(22)15-4-3-9-23-15/h3-4,6-7,9-10,12H,2,5,8,11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | PVUQZLKWSUQAAS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|