C13H17N5O3 — CID 103722946
N-[4-oxo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]butyl]furan-2-carboxamide (PubChem CID 103722946) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[4-oxo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103722946 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[4-oxo-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]butyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1ccco1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H17N5O3/c1-9(12-15-8-16-18-12)17-11(19)5-2-6-14-13(20)10-4-3-7-21-10/h3-4,7-9H,2,5-6H2,1H3,(H,14,20)(H,17,19)(H,15,16,18) |
| InChIKey | GOVQCLCGQOXGKS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|