C10H19N5O — CID 105056271
6-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexanamide (PubChem CID 105056271) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 6-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexanamide.
| Compound Name | 6-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 105056271 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 6-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexanamide |
| SMILES | CC(NC(=O)CCCCCN)c1ncn[nH]1 |
| InChI | InChI=1S/C10H19N5O/c1-8(10-12-7-13-15-10)14-9(16)5-3-2-4-6-11/h7-8H,2-6,11H2,1H3,(H,14,16)(H,12,13,15) |
| InChIKey | ZPGSBUCJMBERKD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|