C8H12N4O2 — CID 106282693
3-oxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]butanamide (PubChem CID 106282693) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-oxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]butanamide.
| Compound Name | 3-oxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 106282693 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-oxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
| SMILES | CC(=O)CC(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H12N4O2/c1-5(13)3-7(14)11-6(2)8-9-4-10-12-8/h4,6H,3H2,1-2H3,(H,11,14)(H,9,10,12) |
| InChIKey | CNXSOWLOGRVDDU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|