C8H10N4O — CID 106741649
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-ynamide (PubChem CID 106741649) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-ynamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-ynamide |
|---|---|
| PubChem CID | 106741649 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]but-2-ynamide |
| SMILES | CC#CC(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H10N4O/c1-3-4-7(13)11-6(2)8-9-5-10-12-8/h5-6H,1-2H3,(H,11,13)(H,9,10,12) |
| InChIKey | YYPPPWNXTDOECA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|