C8H13ClN4O — CID 106282499
3-chloro-2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide (PubChem CID 106282499) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide.
| Compound Name | 3-chloro-2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 106282499 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-chloro-2-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
| SMILES | CC(CCl)C(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H13ClN4O/c1-5(3-9)8(14)12-6(2)7-10-4-11-13-7/h4-6H,3H2,1-2H3,(H,12,14)(H,10,11,13) |
| InChIKey | PCBWQERZBYWYBT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|