C7H13N5O — CID 103815068
3-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide (PubChem CID 103815068) has the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide.
| Compound Name | 3-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103815068 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-amino-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCN)c1ncn[nH]1 |
| InChI | InChI=1S/C7H13N5O/c1-5(7-9-4-10-12-7)11-6(13)2-3-8/h4-5H,2-3,8H2,1H3,(H,11,13)(H,9,10,12) |
| InChIKey | OAOMGKXHHBLMQX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |