C13H24N4O — CID 103722955
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]nonanamide (PubChem CID 103722955) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]nonanamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 103722955 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C13H24N4O/c1-3-4-5-6-7-8-9-12(18)16-11(2)13-14-10-15-17-13/h10-11H,3-9H2,1-2H3,(H,16,18)(H,14,15,17) |
| InChIKey | VMCMAQLYEWXWPL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|