C16H30N4O — CID 65426736
N-[2-(1H-1,2,4-triazol-5-yl)ethyl]dodecanamide (PubChem CID 65426736) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[2-(1H-1,2,4-triazol-5-yl)ethyl]dodecanamide.
| Compound Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]dodecanamide |
|---|---|
| PubChem CID | 65426736 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C16H30N4O/c1-2-3-4-5-6-7-8-9-10-11-16(21)17-13-12-15-18-14-19-20-15/h14H,2-13H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | JSTRSMASCFITES-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|