C14H18N4O2 — CID 64546403
4-phenoxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide (PubChem CID 64546403) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-phenoxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide.
| Compound Name | 4-phenoxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 64546403 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-phenoxy-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H18N4O2/c19-14(15-9-8-13-16-11-17-18-13)7-4-10-20-12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H,15,19)(H,16,17,18) |
| InChIKey | VLLRPCLOPNIAAT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|