C18H21NO3 — CID 110605250
N-[2-(2-hydroxyphenyl)ethyl]-4-phenoxybutanamide (PubChem CID 110605250) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[2-(2-hydroxyphenyl)ethyl]-4-phenoxybutanamide.
| Compound Name | N-[2-(2-hydroxyphenyl)ethyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110605250 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[2-(2-hydroxyphenyl)ethyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCCc1ccccc1O |
| InChI | InChI=1S/C18H21NO3/c20-17-10-5-4-7-15(17)12-13-19-18(21)11-6-14-22-16-8-2-1-3-9-16/h1-5,7-10,20H,6,11-14H2,(H,19,21) |
| InChIKey | LRUPNVISKIUOCS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|