C19H22ClNO3 — CID 31676938
N-[4-(4-chlorophenoxy)butyl]-3-(2-hydroxyphenyl)propanamide (PubChem CID 31676938) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)butyl]-3-(2-hydroxyphenyl)propanamide.
| Compound Name | N-[4-(4-chlorophenoxy)butyl]-3-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 31676938 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-(4-chlorophenoxy)butyl]-3-(2-hydroxyphenyl)propanamide |
| SMILES | O=C(CCc1ccccc1O)NCCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c20-16-8-10-17(11-9-16)24-14-4-3-13-21-19(23)12-7-15-5-1-2-6-18(15)22/h1-2,5-6,8-11,22H,3-4,7,12-14H2,(H,21,23) |
| InChIKey | BAXFSAXCFOAYIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|