C8H13ClN4O — CID 64530629
3-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide (PubChem CID 64530629) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide.
| Compound Name | 3-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
|---|---|
| PubChem CID | 64530629 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
| SMILES | O=C(CCCl)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C8H13ClN4O/c9-4-3-8(14)10-5-1-2-7-11-6-12-13-7/h6H,1-5H2,(H,10,14)(H,11,12,13) |
| InChIKey | SFDHFVBADHOTIN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|