C13H23N5O2 — CID 64547268
6-acetamido-N-[3-(1H-1,2,4-triazol-5-yl)propyl]hexanamide (PubChem CID 64547268) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-acetamido-N-[3-(1H-1,2,4-triazol-5-yl)propyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-(1H-1,2,4-triazol-5-yl)propyl]hexanamide |
|---|---|
| PubChem CID | 64547268 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 6-acetamido-N-[3-(1H-1,2,4-triazol-5-yl)propyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H23N5O2/c1-11(19)14-8-4-2-3-7-13(20)15-9-5-6-12-16-10-17-18-12/h10H,2-9H2,1H3,(H,14,19)(H,15,20)(H,16,17,18) |
| InChIKey | KVIGRKSVMHCNNY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|