C15H20N4O2 — CID 64547070
2-(2,6-dimethylphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64547070) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64547070 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C15H20N4O2/c1-11-5-3-6-12(2)15(11)21-9-14(20)16-8-4-7-13-17-10-18-19-13/h3,5-6,10H,4,7-9H2,1-2H3,(H,16,20)(H,17,18,19) |
| InChIKey | GUUUPNYZODLDRT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|