C14H18N4O3 — CID 64547664
2-(2-methoxyphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64547664) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64547664 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H18N4O3/c1-20-11-5-2-3-6-12(11)21-9-14(19)15-8-4-7-13-16-10-17-18-13/h2-3,5-6,10H,4,7-9H2,1H3,(H,15,19)(H,16,17,18) |
| InChIKey | MRSKNICICJPEDH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|