C15H23NO3 — CID 19169780
N-hexyl-2-(2-methoxyphenoxy)acetamide (PubChem CID 19169780) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-hexyl-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-hexyl-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 19169780 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-hexyl-2-(2-methoxyphenoxy)acetamide |
| SMILES | CCCCCCNC(=O)COc1ccccc1OC |
| InChI | InChI=1S/C15H23NO3/c1-3-4-5-8-11-16-15(17)12-19-14-10-7-6-9-13(14)18-2/h6-7,9-10H,3-5,8,11-12H2,1-2H3,(H,16,17) |
| InChIKey | BXQNKKCPWZQXRB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|