C26H29NO5 — CID 24677341
2-(2-methoxyphenoxy)-N-[4-(4-phenylmethoxyphenoxy)butyl]acetamide (PubChem CID 24677341) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[4-(4-phenylmethoxyphenoxy)butyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[4-(4-phenylmethoxyphenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 24677341 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[4-(4-phenylmethoxyphenoxy)butyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO5/c1-29-24-11-5-6-12-25(24)32-20-26(28)27-17-7-8-18-30-22-13-15-23(16-14-22)31-19-21-9-3-2-4-10-21/h2-6,9-16H,7-8,17-20H2,1H3,(H,27,28) |
| InChIKey | FJUYGWJQGNKKEN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|