C12H16N4O3S — CID 64530073
2-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide (PubChem CID 64530073) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide.
| Compound Name | 2-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64530073 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H16N4O3S/c1-19-10-5-2-3-6-11(10)20(17,18)15-8-4-7-12-13-9-14-16-12/h2-3,5-6,9,15H,4,7-8H2,1H3,(H,13,14,16) |
| InChIKey | SMNNXVUAKDKIPJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|