C11H14FN5O2S — CID 64518565
2-amino-4-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide (PubChem CID 64518565) has the molecular formula C11H14FN5O2S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64518565 |
| Molecular Formula | C11H14FN5O2S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-amino-4-fluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzenesulfonamide |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H14FN5O2S/c12-8-3-4-10(9(13)6-8)20(18,19)16-5-1-2-11-14-7-15-17-11/h3-4,6-7,16H,1-2,5,13H2,(H,14,15,17) |
| InChIKey | LATWWGNRQLZOHO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|