C10H15N7O2S — CID 64531197
4-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-3-sulfonamide (PubChem CID 64531197) has the molecular formula C10H15N7O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-3-sulfonamide.
| Compound Name | 4-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64531197 |
| Molecular Formula | C10H15N7O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-hydrazinyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-3-sulfonamide |
| SMILES | NNc1ccncc1S(=O)(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H15N7O2S/c11-16-8-3-5-12-6-9(8)20(18,19)15-4-1-2-10-13-7-14-17-10/h3,5-7,15H,1-2,4,11H2,(H,12,16)(H,13,14,17) |
| InChIKey | ZZHINYCCUXTPAL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|