C14H16N6 — CID 103138436
8-N-[3-(1H-1,2,4-triazol-5-yl)propyl]isoquinoline-5,8-diamine (PubChem CID 103138436) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 8-N-[3-(1H-1,2,4-triazol-5-yl)propyl]isoquinoline-5,8-diamine.
| Compound Name | 8-N-[3-(1H-1,2,4-triazol-5-yl)propyl]isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103138436 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 8-N-[3-(1H-1,2,4-triazol-5-yl)propyl]isoquinoline-5,8-diamine |
| SMILES | Nc1ccc(NCCCc2ncn[nH]2)c2cnccc12 |
| InChI | InChI=1S/C14H16N6/c15-12-3-4-13(11-8-16-7-5-10(11)12)17-6-1-2-14-18-9-19-20-14/h3-5,7-9,17H,1-2,6,15H2,(H,18,19,20) |
| InChIKey | DHYVOUCSSNKXRS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|