C9H13N7 — CID 102984527
3-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazine-2,3-diamine (PubChem CID 102984527) has the molecular formula C9H13N7 and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazine-2,3-diamine.
| Compound Name | 3-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102984527 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrazine-2,3-diamine |
| SMILES | Nc1nccnc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H13N7/c10-8-9(13-5-4-11-8)12-3-1-2-7-14-6-15-16-7/h4-6H,1-3H2,(H2,10,11)(H,12,13)(H,14,15,16) |
| InChIKey | IIWJDQOJJLCJCY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|