C10H13ClN6O — CID 106195121
6-chloro-5-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine (PubChem CID 106195121) has the molecular formula C10H13ClN6O and a molecular weight of 268.71 g/mol. Its IUPAC name is 6-chloro-5-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106195121 |
| Molecular Formula | C10H13ClN6O |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-chloro-5-methoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine |
| SMILES | COc1c(Cl)ncnc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H13ClN6O/c1-18-8-9(11)14-5-15-10(8)12-4-2-3-7-13-6-16-17-7/h5-6H,2-4H2,1H3,(H,12,14,15)(H,13,16,17) |
| InChIKey | XHXPOEFYVVPKPX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|