C13H19ClN6 — CID 106195112
6-chloro-5-methyl-2-propan-2-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine (PubChem CID 106195112) has the molecular formula C13H19ClN6 and a molecular weight of 294.79 g/mol. Its IUPAC name is 6-chloro-5-methyl-2-propan-2-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-2-propan-2-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106195112 |
| Molecular Formula | C13H19ClN6 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 6-chloro-5-methyl-2-propan-2-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H19ClN6/c1-8(2)12-18-11(14)9(3)13(19-12)15-6-4-5-10-16-7-17-20-10/h7-8H,4-6H2,1-3H3,(H,15,18,19)(H,16,17,20) |
| InChIKey | YDAGPMYDUDCFRY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|