C15H27ClN4 — CID 80971344
N-(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 80971344) has the molecular formula C15H27ClN4 and a molecular weight of 298.86 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 80971344 |
| Molecular Formula | C15H27ClN4 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(C(C)C)nc(Cl)c1C |
| InChI | InChI=1S/C15H27ClN4/c1-6-20(7-2)10-8-9-17-15-12(5)13(16)18-14(19-15)11(3)4/h11H,6-10H2,1-5H3,(H,17,18,19) |
| InChIKey | GRUURCYWJDVIFH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|