C13H22ClN3OS — CID 106311301
3-[2-[(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311301) has the molecular formula C13H22ClN3OS and a molecular weight of 303.86 g/mol. Its IUPAC name is 3-[2-[(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311301 |
| Molecular Formula | C13H22ClN3OS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[2-[(6-chloro-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1NCCSCCCO |
| InChI | InChI=1S/C13H22ClN3OS/c1-9(2)12-16-11(14)10(3)13(17-12)15-5-8-19-7-4-6-18/h9,18H,4-8H2,1-3H3,(H,15,16,17) |
| InChIKey | MVTHLYIUIVNGMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|