C11H18ClN3O2S — CID 80971193
6-chloro-5-methyl-N-(2-methylsulfonylethyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 80971193) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(2-methylsulfonylethyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(2-methylsulfonylethyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80971193 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6-chloro-5-methyl-N-(2-methylsulfonylethyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1NCCS(C)(=O)=O |
| InChI | InChI=1S/C11H18ClN3O2S/c1-7(2)10-14-9(12)8(3)11(15-10)13-5-6-18(4,16)17/h7H,5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | SQECZNYMXBSOHR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |