C13H25N5O — CID 107324334
5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 107324334) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107324334 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | Cc1c(NN)nc(C(C)C)nc1NCCCCCO |
| InChI | InChI=1S/C13H25N5O/c1-9(2)11-16-12(10(3)13(17-11)18-14)15-7-5-4-6-8-19/h9,19H,4-8,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | YVSWNNSUPSUFFZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|