C14H27N5O — CID 106163644
5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]-2-methylpentan-1-ol (PubChem CID 106163644) has the molecular formula C14H27N5O and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106163644 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 5-[(6-hydrazinyl-5-methyl-2-propan-2-ylpyrimidin-4-yl)amino]-2-methylpentan-1-ol |
| SMILES | Cc1c(NN)nc(C(C)C)nc1NCCCC(C)CO |
| InChI | InChI=1S/C14H27N5O/c1-9(2)12-17-13(11(4)14(18-12)19-15)16-7-5-6-10(3)8-20/h9-10,20H,5-8,15H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | HTCZTPNGVKAHKP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|