C8H15N5O — CID 80932442
2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]ethanol (PubChem CID 80932442) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 80932442 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]ethanol |
| SMILES | Cc1nc(NN)c(C)c(NCCO)n1 |
| InChI | InChI=1S/C8H15N5O/c1-5-7(10-3-4-14)11-6(2)12-8(5)13-9/h14H,3-4,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | SCIOAZRIOCYJSF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|