C15H25ClN4O — CID 106193011
N-(6-chloro-5-methoxypyrimidin-4-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 106193011) has the molecular formula C15H25ClN4O and a molecular weight of 312.84 g/mol. Its IUPAC name is N-(6-chloro-5-methoxypyrimidin-4-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-(6-chloro-5-methoxypyrimidin-4-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106193011 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-(6-chloro-5-methoxypyrimidin-4-yl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | COc1c(Cl)ncnc1NCCCN(C)C1CCCCC1 |
| InChI | InChI=1S/C15H25ClN4O/c1-20(12-7-4-3-5-8-12)10-6-9-17-15-13(21-2)14(16)18-11-19-15/h11-12H,3-10H2,1-2H3,(H,17,18,19) |
| InChIKey | KKXVZSDASODXDS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|