C15H24ClN3 — CID 54880422
N-(3-chloro-2-pyridinyl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 54880422) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-(3-chloro-2-pyridinyl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 54880422 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNc1ncccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H24ClN3/c1-19(13-7-3-2-4-8-13)12-6-11-18-15-14(16)9-5-10-17-15/h5,9-10,13H,2-4,6-8,11-12H2,1H3,(H,17,18) |
| InChIKey | DUZDCCAUGTWJQE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|