C8H10Cl2N2 — CID 65030223
3-chloro-N-(3-chloropropyl)pyridin-2-amine (PubChem CID 65030223) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is 3-chloro-N-(3-chloropropyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(3-chloropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 65030223 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 3-chloro-N-(3-chloropropyl)pyridin-2-amine |
| SMILES | ClCCCNc1ncccc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c9-4-2-6-12-8-7(10)3-1-5-11-8/h1,3,5H,2,4,6H2,(H,11,12) |
| InChIKey | BNHOQKBZHPEXPZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|