C8H9ClF2N2 — CID 130735662
3-chloro-N-(3,3-difluoropropyl)pyridin-2-amine (PubChem CID 130735662) has the molecular formula C8H9ClF2N2 and a molecular weight of 206.62 g/mol. Its IUPAC name is 3-chloro-N-(3,3-difluoropropyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(3,3-difluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130735662 |
| Molecular Formula | C8H9ClF2N2 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 3-chloro-N-(3,3-difluoropropyl)pyridin-2-amine |
| SMILES | FC(F)CCNc1ncccc1Cl |
| InChI | InChI=1S/C8H9ClF2N2/c9-6-2-1-4-12-8(6)13-5-3-7(10)11/h1-2,4,7H,3,5H2,(H,12,13) |
| InChIKey | KTGQSACGWSWOOX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |