C12H16ClN3O — CID 79401819
4-[(3-chloro-2-pyridinyl)amino]-N-cyclopropylbutanamide (PubChem CID 79401819) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 4-[(3-chloro-2-pyridinyl)amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(3-chloro-2-pyridinyl)amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79401819 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-[(3-chloro-2-pyridinyl)amino]-N-cyclopropylbutanamide |
| SMILES | O=C(CCCNc1ncccc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H16ClN3O/c13-10-3-1-7-14-12(10)15-8-2-4-11(17)16-9-5-6-9/h1,3,7,9H,2,4-6,8H2,(H,14,15)(H,16,17) |
| InChIKey | FTZTWRQGKFNEPE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|