C16H20N4O — CID 112730869
N-cyclopropyl-4-[(4-methylphthalazin-1-yl)amino]butanamide (PubChem CID 112730869) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[(4-methylphthalazin-1-yl)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(4-methylphthalazin-1-yl)amino]butanamide |
|---|---|
| PubChem CID | 112730869 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-cyclopropyl-4-[(4-methylphthalazin-1-yl)amino]butanamide |
| SMILES | Cc1nnc(NCCCC(=O)NC2CC2)c2ccccc12 |
| InChI | InChI=1S/C16H20N4O/c1-11-13-5-2-3-6-14(13)16(20-19-11)17-10-4-7-15(21)18-12-8-9-12/h2-3,5-6,12H,4,7-10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | GVZFNXQICBWZGO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|