C15H21N3 — CID 60642126
N-hexyl-4-methylphthalazin-1-amine (PubChem CID 60642126) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-hexyl-4-methylphthalazin-1-amine.
| Compound Name | N-hexyl-4-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 60642126 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-hexyl-4-methylphthalazin-1-amine |
| SMILES | CCCCCCNc1nnc(C)c2ccccc12 |
| InChI | InChI=1S/C15H21N3/c1-3-4-5-8-11-16-15-14-10-7-6-9-13(14)12(2)17-18-15/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,16,18) |
| InChIKey | RIHMURAXTRNHBX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|