C13H19N3O3S — CID 114598970
N-cyclopropyl-4-[(3-methylsulfonyl-2-pyridinyl)amino]butanamide (PubChem CID 114598970) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-cyclopropyl-4-[(3-methylsulfonyl-2-pyridinyl)amino]butanamide.
| Compound Name | N-cyclopropyl-4-[(3-methylsulfonyl-2-pyridinyl)amino]butanamide |
|---|---|
| PubChem CID | 114598970 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-cyclopropyl-4-[(3-methylsulfonyl-2-pyridinyl)amino]butanamide |
| SMILES | CS(=O)(=O)c1cccnc1NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-20(18,19)11-4-2-8-14-13(11)15-9-3-5-12(17)16-10-6-7-10/h2,4,8,10H,3,5-7,9H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZDECKXIATSTELR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|