C12H21N3O2S — CID 106155564
2-methyl-N'-(3-methylsulfonyl-2-pyridinyl)pentane-1,5-diamine (PubChem CID 106155564) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-methyl-N'-(3-methylsulfonyl-2-pyridinyl)pentane-1,5-diamine.
| Compound Name | 2-methyl-N'-(3-methylsulfonyl-2-pyridinyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 106155564 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-methyl-N'-(3-methylsulfonyl-2-pyridinyl)pentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H21N3O2S/c1-10(9-13)5-3-7-14-12-11(18(2,16)17)6-4-8-15-12/h4,6,8,10H,3,5,7,9,13H2,1-2H3,(H,14,15) |
| InChIKey | VBQOXFLEQXSVRO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|