C12H21N3O — CID 106155329
N'-(3-methoxy-2-pyridinyl)-2-methylpentane-1,5-diamine (PubChem CID 106155329) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-(3-methoxy-2-pyridinyl)-2-methylpentane-1,5-diamine.
| Compound Name | N'-(3-methoxy-2-pyridinyl)-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 106155329 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N'-(3-methoxy-2-pyridinyl)-2-methylpentane-1,5-diamine |
| SMILES | COc1cccnc1NCCCC(C)CN |
| InChI | InChI=1S/C12H21N3O/c1-10(9-13)5-3-7-14-12-11(16-2)6-4-8-15-12/h4,6,8,10H,3,5,7,9,13H2,1-2H3,(H,14,15) |
| InChIKey | SSRDPVNKQBYQNL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|