C11H18N2O2 — CID 106128585
5-[(3-methoxy-2-pyridinyl)amino]pentan-2-ol (PubChem CID 106128585) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-[(3-methoxy-2-pyridinyl)amino]pentan-2-ol.
| Compound Name | 5-[(3-methoxy-2-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 106128585 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-[(3-methoxy-2-pyridinyl)amino]pentan-2-ol |
| SMILES | COc1cccnc1NCCCC(C)O |
| InChI | InChI=1S/C11H18N2O2/c1-9(14)5-3-7-12-11-10(15-2)6-4-8-13-11/h4,6,8-9,14H,3,5,7H2,1-2H3,(H,12,13) |
| InChIKey | XTRKHSPBYMVRKH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|