C11H17BrN2O — CID 106129032
5-[(3-bromo-4-methyl-2-pyridinyl)amino]pentan-2-ol (PubChem CID 106129032) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 5-[(3-bromo-4-methyl-2-pyridinyl)amino]pentan-2-ol.
| Compound Name | 5-[(3-bromo-4-methyl-2-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 106129032 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-[(3-bromo-4-methyl-2-pyridinyl)amino]pentan-2-ol |
| SMILES | Cc1ccnc(NCCCC(C)O)c1Br |
| InChI | InChI=1S/C11H17BrN2O/c1-8-5-7-14-11(10(8)12)13-6-3-4-9(2)15/h5,7,9,15H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | JLRWRDDIMGZCMT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|